C33H33N3O4S3 — CID 18912178
methyl 2-[[2-[3-(4a,10a-dihydrophenothiazine-10-carbonylamino)phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 18912178) has the molecular formula C33H33N3O4S3 and a molecular weight of 631.85 g/mol. Its IUPAC name is methyl 2-[[2-[3-(4a,10a-dihydrophenothiazine-10-carbonylamino)phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[3-(4a,10a-dihydrophenothiazine-10-carbonylamino)phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18912178 |
| Molecular Formula | C33H33N3O4S3 |
| Molecular Weight | 631.85 g/mol |
| Exact Mass | 631.16 |
| IUPAC Name | methyl 2-[[2-[3-(4a,10a-dihydrophenothiazine-10-carbonylamino)phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CSc2cccc(NC(=O)N3c4ccccc4SC4C=CC=CC43)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C33H33N3O4S3/c1-40-32(38)30-23-13-4-2-3-5-16-26(23)43-31(30)35-29(37)20-41-22-12-10-11-21(19-22)34-33(39)36-24-14-6-8-17-27(24)42-28-18-9-7-15-25(28)36/h6-12,14-15,17-19,24,27H,2-5,13,16,20H2,1H3,(H,34,39)(H,35,37) |
| InChIKey | JDRBABLTKUNKRR-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.85 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |