C14H24N4O9 — CID 18915907
4-[[1,7-bis(hydroxyamino)-4-[3-(hydroxyamino)-3-oxopropyl]-1,7-dioxoheptan-4-yl]amino]-4-oxobutanoic acid (PubChem CID 18915907) has the molecular formula C14H24N4O9 and a molecular weight of 392.37 g/mol. Its IUPAC name is 4-[[1,7-bis(hydroxyamino)-4-[3-(hydroxyamino)-3-oxopropyl]-1,7-dioxoheptan-4-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[1,7-bis(hydroxyamino)-4-[3-(hydroxyamino)-3-oxopropyl]-1,7-dioxoheptan-4-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18915907 |
| Molecular Formula | C14H24N4O9 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 4-[[1,7-bis(hydroxyamino)-4-[3-(hydroxyamino)-3-oxopropyl]-1,7-dioxoheptan-4-yl]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NC(CCC(=O)NO)(CCC(=O)NO)CCC(=O)NO |
| InChI | InChI=1S/C14H24N4O9/c19-9(1-2-13(23)24)15-14(6-3-10(20)16-25,7-4-11(21)17-26)8-5-12(22)18-27/h25-27H,1-8H2,(H,15,19)(H,16,20)(H,17,21)(H,18,22)(H,23,24) |
| InChIKey | PFTPIMXKPBWFGF-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 214.39 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|