C21H15F2NO2 — CID 18923169
(2,6-difluorophenyl) 10-methyl-1H-acridine-9-carboxylate (PubChem CID 18923169) has the molecular formula C21H15F2NO2 and a molecular weight of 351.35 g/mol. Its IUPAC name is (2,6-difluorophenyl) 10-methyl-1H-acridine-9-carboxylate.
| Compound Name | (2,6-difluorophenyl) 10-methyl-1H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 18923169 |
| Molecular Formula | C21H15F2NO2 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (2,6-difluorophenyl) 10-methyl-1H-acridine-9-carboxylate |
| SMILES | CN1C2=CC=CCC2=C(C(=O)Oc2c(F)cccc2F)c2ccccc21 |
| InChI | InChI=1S/C21H15F2NO2/c1-24-17-11-4-2-7-13(17)19(14-8-3-5-12-18(14)24)21(25)26-20-15(22)9-6-10-16(20)23/h2-7,9-12H,8H2,1H3 |
| InChIKey | ACLVWUYZXPZVME-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|