C17H24NO2- — CID 18928792
1-benzyl-2-ethyl-5-methyl-3,6-dihydro-2H-pyridine acetate (PubChem CID 18928792) has the molecular formula C17H24NO2- and a molecular weight of 274.38 g/mol. Its IUPAC name is 1-benzyl-2-ethyl-5-methyl-3,6-dihydro-2H-pyridine acetate.
| Compound Name | 1-benzyl-2-ethyl-5-methyl-3,6-dihydro-2H-pyridine acetate |
|---|---|
| PubChem CID | 18928792 |
| Molecular Formula | C17H24NO2- |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 1-benzyl-2-ethyl-5-methyl-3,6-dihydro-2H-pyridine acetate |
| SMILES | CC(=O)[O-].CCC1CC=C(C)CN1Cc1ccccc1 |
| InChI | InChI=1S/C15H21N.C2H4O2/c1-3-15-10-9-13(2)11-16(15)12-14-7-5-4-6-8-14;1-2(3)4/h4-9,15H,3,10-12H2,1-2H3;1H3,(H,3,4)/p-1 |
| InChIKey | CNDKWGMUCLQCSY-UHFFFAOYSA-M |
| XLogP | 2.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|