C18H20O4 — CID 18932645
5,8-dimethoxy-3-(phenoxymethyl)-3,4-dihydro-1H-isochromene (PubChem CID 18932645) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 5,8-dimethoxy-3-(phenoxymethyl)-3,4-dihydro-1H-isochromene.
| Compound Name | 5,8-dimethoxy-3-(phenoxymethyl)-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 18932645 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 5,8-dimethoxy-3-(phenoxymethyl)-3,4-dihydro-1H-isochromene |
| SMILES | COc1ccc(OC)c2c1COC(COc1ccccc1)C2 |
| InChI | InChI=1S/C18H20O4/c1-19-17-8-9-18(20-2)16-12-22-14(10-15(16)17)11-21-13-6-4-3-5-7-13/h3-9,14H,10-12H2,1-2H3 |
| InChIKey | UADRLOLKZGLRJL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |