C14H20Cl2O8 — CID 18939198
[6-(2-chloro-2-oxoacetyl)peroxy-3,6-dimethyloctan-3-yl] 2-chloro-2-oxoethaneperoxoate (PubChem CID 18939198) has the molecular formula C14H20Cl2O8 and a molecular weight of 387.21 g/mol. Its IUPAC name is [6-(2-chloro-2-oxoacetyl)peroxy-3,6-dimethyloctan-3-yl] 2-chloro-2-oxoethaneperoxoate.
| Compound Name | [6-(2-chloro-2-oxoacetyl)peroxy-3,6-dimethyloctan-3-yl] 2-chloro-2-oxoethaneperoxoate |
|---|---|
| PubChem CID | 18939198 |
| Molecular Formula | C14H20Cl2O8 |
| Molecular Weight | 387.21 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | [6-(2-chloro-2-oxoacetyl)peroxy-3,6-dimethyloctan-3-yl] 2-chloro-2-oxoethaneperoxoate |
| SMILES | CCC(C)(CCC(C)(CC)OOC(=O)C(=O)Cl)OOC(=O)C(=O)Cl |
| InChI | InChI=1S/C14H20Cl2O8/c1-5-13(3,23-21-11(19)9(15)17)7-8-14(4,6-2)24-22-12(20)10(16)18/h5-8H2,1-4H3 |
| InChIKey | DPNJBAAXASSQNN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|