About 3-ethylpentan-3-yl 2-chloro-2-oxoacetate
3-ethylpentan-3-yl 2-chloro-2-oxoacetate (PubChem CID 129294112) has the molecular formula C9H15ClO3
and a molecular weight of 206.67 g/mol. Its IUPAC name is 3-ethylpentan-3-yl 2-chloro-2-oxoacetate.
Molecular Properties
| Compound Name | 3-ethylpentan-3-yl 2-chloro-2-oxoacetate |
| PubChem CID | 129294112 |
| Molecular Formula | C9H15ClO3 |
| Molecular Weight | 206.67 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 3-ethylpentan-3-yl 2-chloro-2-oxoacetate |
| SMILES | CCC(CC)(CC)OC(=O)C(=O)Cl |
| InChI | InChI=1S/C9H15ClO3/c1-4-9(5-2,6-3)13-8(12)7(10)11/h4-6H2,1-3H3 |
| InChIKey | IBGODMUTSPQHLW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.67 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylpentan-3-yl 2-chloro-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylpentan-3-yl 2-chloro-2-oxoacetate?
The IUPAC name of 3-ethylpentan-3-yl 2-chloro-2-oxoacetate (CID 129294112) is 3-ethylpentan-3-yl 2-chloro-2-oxoacetate.
What is the SMILES notation for 3-ethylpentan-3-yl 2-chloro-2-oxoacetate?
The canonical SMILES for 3-ethylpentan-3-yl 2-chloro-2-oxoacetate is CCC(CC)(CC)OC(=O)C(=O)Cl.
What is the InChIKey of 3-ethylpentan-3-yl 2-chloro-2-oxoacetate?
The InChIKey is IBGODMUTSPQHLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClO3/c1-4-9(5-2,6-3)13-8(12)7(10)11/h4-6H2,1-3H3.
What are the key properties of 3-ethylpentan-3-yl 2-chloro-2-oxoacetate?
3-ethylpentan-3-yl 2-chloro-2-oxoacetate has a molecular weight of 206.67 g/mol, XLogP of 2.26, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylpentan-3-yl 2-chloro-2-oxoacetate is sourced from PubChem (CID 129294112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).