C15H28O2 — CID 130227839
3-ethylpentan-3-yl 4,4-dimethyl-2-methylidenepentanoate (PubChem CID 130227839) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 3-ethylpentan-3-yl 4,4-dimethyl-2-methylidenepentanoate.
| Compound Name | 3-ethylpentan-3-yl 4,4-dimethyl-2-methylidenepentanoate |
|---|---|
| PubChem CID | 130227839 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 3-ethylpentan-3-yl 4,4-dimethyl-2-methylidenepentanoate |
| SMILES | C=C(CC(C)(C)C)C(=O)OC(CC)(CC)CC |
| InChI | InChI=1S/C15H28O2/c1-8-15(9-2,10-3)17-13(16)12(4)11-14(5,6)7/h4,8-11H2,1-3,5-7H3 |
| InChIKey | IJCWGUJRNYTHRJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|