About 1-ethenyl-4-ethylbenzene
1-ethenyl-4-ethylbenzene (PubChem CID 18940) has the molecular formula C10H12
and a molecular weight of 132.21 g/mol. Its IUPAC name is 1-ethenyl-4-ethylbenzene.
Molecular Properties
| Compound Name | 1-ethenyl-4-ethylbenzene |
| PubChem CID | 18940 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 1-ethenyl-4-ethylbenzene |
| SMILES | C=Cc1ccc(CC)cc1 |
| InChI | InChI=1S/C10H12/c1-3-9-5-7-10(4-2)8-6-9/h3,5-8H,1,4H2,2H3 |
| InChIKey | WHFHDVDXYKOSKI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethenyl-4-ethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-4-ethylbenzene?
The IUPAC name of 1-ethenyl-4-ethylbenzene (CID 18940) is 1-ethenyl-4-ethylbenzene.
What is the SMILES notation for 1-ethenyl-4-ethylbenzene?
The canonical SMILES for 1-ethenyl-4-ethylbenzene is C=Cc1ccc(CC)cc1.
What is the InChIKey of 1-ethenyl-4-ethylbenzene?
The InChIKey is WHFHDVDXYKOSKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12/c1-3-9-5-7-10(4-2)8-6-9/h3,5-8H,1,4H2,2H3.
What are the key properties of 1-ethenyl-4-ethylbenzene?
1-ethenyl-4-ethylbenzene has a molecular weight of 132.21 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-4-ethylbenzene is sourced from PubChem (CID 18940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).