C13H20O4 — CID 18943224
ethoxymethoxyethane;2-ethoxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene (PubChem CID 18943224) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is ethoxymethoxyethane;2-ethoxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene.
| Compound Name | ethoxymethoxyethane;2-ethoxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 18943224 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | ethoxymethoxyethane;2-ethoxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene |
| SMILES | CCOCOCC.CCOc1cc2ccc1o2 |
| InChI | InChI=1S/C8H8O2.C5H12O2/c1-2-9-8-5-6-3-4-7(8)10-6;1-3-6-5-7-4-2/h3-5H,2H2,1H3;3-5H2,1-2H3 |
| InChIKey | KQMUGCOHZCKOMX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 40.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|