About ethanamine;7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-ol
ethanamine;7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-ol (PubChem CID 21291607) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is ethanamine;7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-ol.
Molecular Properties
| Compound Name | ethanamine;7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-ol |
| PubChem CID | 21291607 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | ethanamine;7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-ol |
| SMILES | CCN.Oc1cc2ccc1o2 |
| InChI | InChI=1S/C6H4O2.C2H7N/c7-5-3-4-1-2-6(5)8-4;1-2-3/h1-3,7H;2-3H2,1H3 |
| InChIKey | NZIHWVMSXLXZLY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethanamine;7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-ol?
The IUPAC name of ethanamine;7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-ol (CID 21291607) is ethanamine;7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-ol.
What is the SMILES notation for ethanamine;7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-ol?
The canonical SMILES for ethanamine;7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-ol is CCN.Oc1cc2ccc1o2.
What is the InChIKey of ethanamine;7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-ol?
The InChIKey is NZIHWVMSXLXZLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O2.C2H7N/c7-5-3-4-1-2-6(5)8-4;1-2-3/h1-3,7H;2-3H2,1H3.
What are the key properties of ethanamine;7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-ol?
ethanamine;7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-ol has a molecular weight of 153.18 g/mol, XLogP of 1.54, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-ol is sourced from PubChem (CID 21291607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).