C38H68O6Si2 — CID 18943853
[3-[tert-butyl(dimethyl)silyl]oxy-8-[2-[4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 3-methyl-2-propan-2-ylbutanoate (PubChem CID 18943853) has the molecular formula C38H68O6Si2 and a molecular weight of 677.13 g/mol. Its IUPAC name is [3-[tert-butyl(dimethyl)silyl]oxy-8-[2-[4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 3-methyl-2-propan-2-ylbutanoate.
| Compound Name | [3-[tert-butyl(dimethyl)silyl]oxy-8-[2-[4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 3-methyl-2-propan-2-ylbutanoate |
|---|---|
| PubChem CID | 18943853 |
| Molecular Formula | C38H68O6Si2 |
| Molecular Weight | 677.13 g/mol |
| Exact Mass | 676.46 |
| IUPAC Name | [3-[tert-butyl(dimethyl)silyl]oxy-8-[2-[4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 3-methyl-2-propan-2-ylbutanoate |
| SMILES | CC(C)C(C(=O)OC1CC(O[Si](C)(C)C(C)(C)C)C=C2C=CC(C)C(CCC3CC(O[Si](C)(C)C(C)(C)C)CC(=O)O3)C21)C(C)C |
| InChI | InChI=1S/C38H68O6Si2/c1-24(2)34(25(3)4)36(40)42-32-22-29(43-45(12,13)37(6,7)8)20-27-17-16-26(5)31(35(27)32)19-18-28-21-30(23-33(39)41-28)44-46(14,15)38(9,10)11/h16-17,20,24-26,28-32,34-35H,18-19,21-23H2,1-15H3 |
| InChIKey | ULVTWCYLZIAOSY-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.13 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|