About azido N-diazosulfamate
azido N-diazosulfamate (PubChem CID 18945546) has the molecular formula N6O3S
and a molecular weight of 164.11 g/mol. Its IUPAC name is azido N-diazosulfamate.
Molecular Properties
| Compound Name | azido N-diazosulfamate |
| PubChem CID | 18945546 |
| Molecular Formula | N6O3S |
| Molecular Weight | 164.11 g/mol |
| Exact Mass | 163.98 |
| IUPAC Name | azido N-diazosulfamate |
| SMILES | [N-]=[N+]=NOS(=O)(=O)N=[N+]=[N-] |
| InChI | InChI=1S/N6O3S/c1-3-5-9-10(7,8)6-4-2 |
| InChIKey | DNKNHOROYCLEPN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 140.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.11 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze azido N-diazosulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azido N-diazosulfamate?
The IUPAC name of azido N-diazosulfamate (CID 18945546) is azido N-diazosulfamate.
What is the SMILES notation for azido N-diazosulfamate?
The canonical SMILES for azido N-diazosulfamate is [N-]=[N+]=NOS(=O)(=O)N=[N+]=[N-].
What is the InChIKey of azido N-diazosulfamate?
The InChIKey is DNKNHOROYCLEPN-UHFFFAOYSA-N. The full InChI is InChI=1S/N6O3S/c1-3-5-9-10(7,8)6-4-2.
What are the key properties of azido N-diazosulfamate?
azido N-diazosulfamate has a molecular weight of 164.11 g/mol, XLogP of 0.78, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azido N-diazosulfamate is sourced from PubChem (CID 18945546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).