About O-azidosulfonyl methanethioate
O-azidosulfonyl methanethioate (PubChem CID 135223066) has the molecular formula CHN3O3S2
and a molecular weight of 167.17 g/mol. Its IUPAC name is O-azidosulfonyl methanethioate.
Molecular Properties
| Compound Name | O-azidosulfonyl methanethioate |
| PubChem CID | 135223066 |
| Molecular Formula | CHN3O3S2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 166.95 |
| IUPAC Name | O-azidosulfonyl methanethioate |
| SMILES | [N-]=[N+]=NS(=O)(=O)OC=S |
| InChI | InChI=1S/CHN3O3S2/c2-3-4-9(5,6)7-1-8/h1H |
| InChIKey | BUBDJDWSENSFFD-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-azidosulfonyl methanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-azidosulfonyl methanethioate?
The IUPAC name of O-azidosulfonyl methanethioate (CID 135223066) is O-azidosulfonyl methanethioate.
What is the SMILES notation for O-azidosulfonyl methanethioate?
The canonical SMILES for O-azidosulfonyl methanethioate is [N-]=[N+]=NS(=O)(=O)OC=S.
What is the InChIKey of O-azidosulfonyl methanethioate?
The InChIKey is BUBDJDWSENSFFD-UHFFFAOYSA-N. The full InChI is InChI=1S/CHN3O3S2/c2-3-4-9(5,6)7-1-8/h1H.
What are the key properties of O-azidosulfonyl methanethioate?
O-azidosulfonyl methanethioate has a molecular weight of 167.17 g/mol, XLogP of 0.52, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-azidosulfonyl methanethioate is sourced from PubChem (CID 135223066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).