C3H4F3N3O2S — CID 150037607
N-diazo-3,3,3-trifluoropropane-1-sulfonamide (PubChem CID 150037607) has the molecular formula C3H4F3N3O2S and a molecular weight of 203.14 g/mol. Its IUPAC name is N-diazo-3,3,3-trifluoropropane-1-sulfonamide.
| Compound Name | N-diazo-3,3,3-trifluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 150037607 |
| Molecular Formula | C3H4F3N3O2S |
| Molecular Weight | 203.14 g/mol |
| Exact Mass | 203.00 |
| IUPAC Name | N-diazo-3,3,3-trifluoropropane-1-sulfonamide |
| SMILES | [N-]=[N+]=NS(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C3H4F3N3O2S/c4-3(5,6)1-2-12(10,11)9-8-7/h1-2H2 |
| InChIKey | DIPAKBQLKNGAHZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.14 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|