C9H6F13N3 — CID 89422665
1-azido-1,1,2,2,3,3,4,4,5,5,9,9,9-tridecafluorononane (PubChem CID 89422665) has the molecular formula C9H6F13N3 and a molecular weight of 403.14 g/mol. Its IUPAC name is 1-azido-1,1,2,2,3,3,4,4,5,5,9,9,9-tridecafluorononane.
| Compound Name | 1-azido-1,1,2,2,3,3,4,4,5,5,9,9,9-tridecafluorononane |
|---|---|
| PubChem CID | 89422665 |
| Molecular Formula | C9H6F13N3 |
| Molecular Weight | 403.14 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 1-azido-1,1,2,2,3,3,4,4,5,5,9,9,9-tridecafluorononane |
| SMILES | [N-]=[N+]=NC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCC(F)(F)F |
| InChI | InChI=1S/C9H6F13N3/c10-4(11,2-1-3-5(12,13)14)6(15,16)7(17,18)8(19,20)9(21,22)24-25-23/h1-3H2 |
| InChIKey | OAXQNVYLIFCXKC-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.14 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|