C5H9N3O4S — CID 57207034
N-diazo-2-(oxiran-2-ylmethoxy)ethanesulfonamide (PubChem CID 57207034) has the molecular formula C5H9N3O4S and a molecular weight of 207.21 g/mol. Its IUPAC name is N-diazo-2-(oxiran-2-ylmethoxy)ethanesulfonamide.
| Compound Name | N-diazo-2-(oxiran-2-ylmethoxy)ethanesulfonamide |
|---|---|
| PubChem CID | 57207034 |
| Molecular Formula | C5H9N3O4S |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | N-diazo-2-(oxiran-2-ylmethoxy)ethanesulfonamide |
| SMILES | [N-]=[N+]=NS(=O)(=O)CCOCC1CO1 |
| InChI | InChI=1S/C5H9N3O4S/c6-7-8-13(9,10)2-1-11-3-5-4-12-5/h5H,1-4H2 |
| InChIKey | ZFGHXBHLHQTTPS-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 104.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|