About 2-fluorodecyl methanesulfonate
2-fluorodecyl methanesulfonate (PubChem CID 18945857) has the molecular formula C11H23FO3S
and a molecular weight of 254.37 g/mol. Its IUPAC name is 2-fluorodecyl methanesulfonate.
Molecular Properties
| Compound Name | 2-fluorodecyl methanesulfonate |
| PubChem CID | 18945857 |
| Molecular Formula | C11H23FO3S |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 2-fluorodecyl methanesulfonate |
| SMILES | CCCCCCCCC(F)COS(C)(=O)=O |
| InChI | InChI=1S/C11H23FO3S/c1-3-4-5-6-7-8-9-11(12)10-15-16(2,13)14/h11H,3-10H2,1-2H3 |
| InChIKey | SWFBATICFJIXPH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-fluorodecyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorodecyl methanesulfonate?
The IUPAC name of 2-fluorodecyl methanesulfonate (CID 18945857) is 2-fluorodecyl methanesulfonate.
What is the SMILES notation for 2-fluorodecyl methanesulfonate?
The canonical SMILES for 2-fluorodecyl methanesulfonate is CCCCCCCCC(F)COS(C)(=O)=O.
What is the InChIKey of 2-fluorodecyl methanesulfonate?
The InChIKey is SWFBATICFJIXPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23FO3S/c1-3-4-5-6-7-8-9-11(12)10-15-16(2,13)14/h11H,3-10H2,1-2H3.
What are the key properties of 2-fluorodecyl methanesulfonate?
2-fluorodecyl methanesulfonate has a molecular weight of 254.37 g/mol, XLogP of 3.05, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorodecyl methanesulfonate is sourced from PubChem (CID 18945857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).