About 4-fluorotridecylsulfonyl 4-fluorotridecane-1-sulfonate
4-fluorotridecylsulfonyl 4-fluorotridecane-1-sulfonate (PubChem CID 88671655) has the molecular formula C26H52F2O5S2
and a molecular weight of 546.83 g/mol. Its IUPAC name is 4-fluorotridecylsulfonyl 4-fluorotridecane-1-sulfonate.
Molecular Properties
| Compound Name | 4-fluorotridecylsulfonyl 4-fluorotridecane-1-sulfonate |
| PubChem CID | 88671655 |
| Molecular Formula | C26H52F2O5S2 |
| Molecular Weight | 546.83 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | 4-fluorotridecylsulfonyl 4-fluorotridecane-1-sulfonate |
| SMILES | CCCCCCCCCC(F)CCCS(=O)(=O)OS(=O)(=O)CCCC(F)CCCCCCCCC |
| InChI | InChI=1S/C26H52F2O5S2/c1-3-5-7-9-11-13-15-19-25(27)21-17-23-34(29,30)33-35(31,32)24-18-22-26(28)20-16-14-12-10-8-6-4-2/h25-26H,3-24H2,1-2H3 |
| InChIKey | CFTNOWKJFVYXIP-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.83 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-fluorotridecylsulfonyl 4-fluorotridecane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorotridecylsulfonyl 4-fluorotridecane-1-sulfonate?
The IUPAC name of 4-fluorotridecylsulfonyl 4-fluorotridecane-1-sulfonate (CID 88671655) is 4-fluorotridecylsulfonyl 4-fluorotridecane-1-sulfonate.
What is the SMILES notation for 4-fluorotridecylsulfonyl 4-fluorotridecane-1-sulfonate?
The canonical SMILES for 4-fluorotridecylsulfonyl 4-fluorotridecane-1-sulfonate is CCCCCCCCCC(F)CCCS(=O)(=O)OS(=O)(=O)CCCC(F)CCCCCCCCC.
What is the InChIKey of 4-fluorotridecylsulfonyl 4-fluorotridecane-1-sulfonate?
The InChIKey is CFTNOWKJFVYXIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H52F2O5S2/c1-3-5-7-9-11-13-15-19-25(27)21-17-23-34(29,30)33-35(31,32)24-18-22-26(28)20-16-14-12-10-8-6-4-2/h25-26H,3-24H2,1-2H3.
What are the key properties of 4-fluorotridecylsulfonyl 4-fluorotridecane-1-sulfonate?
4-fluorotridecylsulfonyl 4-fluorotridecane-1-sulfonate has a molecular weight of 546.83 g/mol, XLogP of 8.18, 26 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorotridecylsulfonyl 4-fluorotridecane-1-sulfonate is sourced from PubChem (CID 88671655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).