About 3-fluoroundecoxy methanesulfonate
3-fluoroundecoxy methanesulfonate (PubChem CID 19105699) has the molecular formula C12H25FO4S
and a molecular weight of 284.39 g/mol. Its IUPAC name is 3-fluoroundecoxy methanesulfonate.
Molecular Properties
| Compound Name | 3-fluoroundecoxy methanesulfonate |
| PubChem CID | 19105699 |
| Molecular Formula | C12H25FO4S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 3-fluoroundecoxy methanesulfonate |
| SMILES | CCCCCCCCC(F)CCOOS(C)(=O)=O |
| InChI | InChI=1S/C12H25FO4S/c1-3-4-5-6-7-8-9-12(13)10-11-16-17-18(2,14)15/h12H,3-11H2,1-2H3 |
| InChIKey | VSGRSWPCDRBSAR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoroundecoxy methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoroundecoxy methanesulfonate?
The IUPAC name of 3-fluoroundecoxy methanesulfonate (CID 19105699) is 3-fluoroundecoxy methanesulfonate.
What is the SMILES notation for 3-fluoroundecoxy methanesulfonate?
The canonical SMILES for 3-fluoroundecoxy methanesulfonate is CCCCCCCCC(F)CCOOS(C)(=O)=O.
What is the InChIKey of 3-fluoroundecoxy methanesulfonate?
The InChIKey is VSGRSWPCDRBSAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25FO4S/c1-3-4-5-6-7-8-9-12(13)10-11-16-17-18(2,14)15/h12H,3-11H2,1-2H3.
What are the key properties of 3-fluoroundecoxy methanesulfonate?
3-fluoroundecoxy methanesulfonate has a molecular weight of 284.39 g/mol, XLogP of 3.37, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoroundecoxy methanesulfonate is sourced from PubChem (CID 19105699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).