C29H25N3O2 — CID 18946972
1-butyl-2-[(2-cyanoindol-1-yl)-phenylmethyl]indole-3-carboxylic acid (PubChem CID 18946972) has the molecular formula C29H25N3O2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 1-butyl-2-[(2-cyanoindol-1-yl)-phenylmethyl]indole-3-carboxylic acid.
| Compound Name | 1-butyl-2-[(2-cyanoindol-1-yl)-phenylmethyl]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 18946972 |
| Molecular Formula | C29H25N3O2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 1-butyl-2-[(2-cyanoindol-1-yl)-phenylmethyl]indole-3-carboxylic acid |
| SMILES | CCCCn1c(C(c2ccccc2)n2c(C#N)cc3ccccc32)c(C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C29H25N3O2/c1-2-3-17-31-25-16-10-8-14-23(25)26(29(33)34)28(31)27(20-11-5-4-6-12-20)32-22(19-30)18-21-13-7-9-15-24(21)32/h4-16,18,27H,2-3,17H2,1H3,(H,33,34) |
| InChIKey | LEHWXRTWUVYCHS-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |