C29H24N2O3 — CID 18946785
1-butyl-2-[(2-cyano-1-benzofuran-3-yl)-phenylmethyl]indole-3-carboxylic acid (PubChem CID 18946785) has the molecular formula C29H24N2O3 and a molecular weight of 448.52 g/mol. Its IUPAC name is 1-butyl-2-[(2-cyano-1-benzofuran-3-yl)-phenylmethyl]indole-3-carboxylic acid.
| Compound Name | 1-butyl-2-[(2-cyano-1-benzofuran-3-yl)-phenylmethyl]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 18946785 |
| Molecular Formula | C29H24N2O3 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 1-butyl-2-[(2-cyano-1-benzofuran-3-yl)-phenylmethyl]indole-3-carboxylic acid |
| SMILES | CCCCn1c(C(c2ccccc2)c2c(C#N)oc3ccccc23)c(C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C29H24N2O3/c1-2-3-17-31-22-15-9-7-13-20(22)27(29(32)33)28(31)25(19-11-5-4-6-12-19)26-21-14-8-10-16-23(21)34-24(26)18-30/h4-16,25H,2-3,17H2,1H3,(H,32,33) |
| InChIKey | MCBGUOFFEZQMOL-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |