C17H13N3O2 — CID 18950202
3-(4-anilinophenyl)-2,3-dicyanopropanoic acid (PubChem CID 18950202) has the molecular formula C17H13N3O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 3-(4-anilinophenyl)-2,3-dicyanopropanoic acid.
| Compound Name | 3-(4-anilinophenyl)-2,3-dicyanopropanoic acid |
|---|---|
| PubChem CID | 18950202 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 3-(4-anilinophenyl)-2,3-dicyanopropanoic acid |
| SMILES | N#CC(C(=O)O)C(C#N)c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C17H13N3O2/c18-10-15(16(11-19)17(21)22)12-6-8-14(9-7-12)20-13-4-2-1-3-5-13/h1-9,15-16,20H,(H,21,22) |
| InChIKey | VKDLIXUWQXFLTG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |