C8H9NO5 — CID 18955501
2-(2,3-dihydroxyphenyl)-N,2-dihydroxyacetamide (PubChem CID 18955501) has the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. Its IUPAC name is 2-(2,3-dihydroxyphenyl)-N,2-dihydroxyacetamide.
| Compound Name | 2-(2,3-dihydroxyphenyl)-N,2-dihydroxyacetamide |
|---|---|
| PubChem CID | 18955501 |
| Molecular Formula | C8H9NO5 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 2-(2,3-dihydroxyphenyl)-N,2-dihydroxyacetamide |
| SMILES | O=C(NO)C(O)c1cccc(O)c1O |
| InChI | InChI=1S/C8H9NO5/c10-5-3-1-2-4(6(5)11)7(12)8(13)9-14/h1-3,7,10-12,14H,(H,9,13) |
| InChIKey | MOHATNOYUAQARQ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|