About 5-ethyl-4-[(3-ethyl-2-propyloctoxy)methyl]decane;propane-1,2-diol
5-ethyl-4-[(3-ethyl-2-propyloctoxy)methyl]decane;propane-1,2-diol (PubChem CID 18962822) has the molecular formula C29H62O3
and a molecular weight of 458.81 g/mol. Its IUPAC name is 5-ethyl-4-[(3-ethyl-2-propyloctoxy)methyl]decane;propane-1,2-diol.
Molecular Properties
| Compound Name | 5-ethyl-4-[(3-ethyl-2-propyloctoxy)methyl]decane;propane-1,2-diol |
| PubChem CID | 18962822 |
| Molecular Formula | C29H62O3 |
| Molecular Weight | 458.81 g/mol |
| Exact Mass | 458.47 |
| IUPAC Name | 5-ethyl-4-[(3-ethyl-2-propyloctoxy)methyl]decane;propane-1,2-diol |
| SMILES | CC(O)CO.CCCCCC(CC)C(CCC)COCC(CCC)C(CC)CCCCC |
| InChI | InChI=1S/C26H54O.C3H8O2/c1-7-13-15-19-23(11-5)25(17-9-3)21-27-22-26(18-10-4)24(12-6)20-16-14-8-2;1-3(5)2-4/h23-26H,7-22H2,1-6H3;3-5H,2H2,1H3 |
| InChIKey | UZJKQRRPLBTHJU-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.81 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-4-[(3-ethyl-2-propyloctoxy)methyl]decane;propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4-[(3-ethyl-2-propyloctoxy)methyl]decane;propane-1,2-diol?
The IUPAC name of 5-ethyl-4-[(3-ethyl-2-propyloctoxy)methyl]decane;propane-1,2-diol (CID 18962822) is 5-ethyl-4-[(3-ethyl-2-propyloctoxy)methyl]decane;propane-1,2-diol.
What is the SMILES notation for 5-ethyl-4-[(3-ethyl-2-propyloctoxy)methyl]decane;propane-1,2-diol?
The canonical SMILES for 5-ethyl-4-[(3-ethyl-2-propyloctoxy)methyl]decane;propane-1,2-diol is CC(O)CO.CCCCCC(CC)C(CCC)COCC(CCC)C(CC)CCCCC.
What is the InChIKey of 5-ethyl-4-[(3-ethyl-2-propyloctoxy)methyl]decane;propane-1,2-diol?
The InChIKey is UZJKQRRPLBTHJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H54O.C3H8O2/c1-7-13-15-19-23(11-5)25(17-9-3)21-27-22-26(18-10-4)24(12-6)20-16-14-8-2;1-3(5)2-4/h23-26H,7-22H2,1-6H3;3-5H,2H2,1H3.
What are the key properties of 5-ethyl-4-[(3-ethyl-2-propyloctoxy)methyl]decane;propane-1,2-diol?
5-ethyl-4-[(3-ethyl-2-propyloctoxy)methyl]decane;propane-1,2-diol has a molecular weight of 458.81 g/mol, XLogP of 8.41, 21 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4-[(3-ethyl-2-propyloctoxy)methyl]decane;propane-1,2-diol is sourced from PubChem (CID 18962822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).