C20H18Cl2FN5O2S — CID 18967681
[4-[3-fluoro-4-(1-methylimidazol-2-yl)sulfanylanilino]quinazolin-6-yl] acetate;dihydrochloride (PubChem CID 18967681) has the molecular formula C20H18Cl2FN5O2S and a molecular weight of 482.37 g/mol. Its IUPAC name is [4-[3-fluoro-4-(1-methylimidazol-2-yl)sulfanylanilino]quinazolin-6-yl] acetate;dihydrochloride.
| Compound Name | [4-[3-fluoro-4-(1-methylimidazol-2-yl)sulfanylanilino]quinazolin-6-yl] acetate;dihydrochloride |
|---|---|
| PubChem CID | 18967681 |
| Molecular Formula | C20H18Cl2FN5O2S |
| Molecular Weight | 482.37 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | [4-[3-fluoro-4-(1-methylimidazol-2-yl)sulfanylanilino]quinazolin-6-yl] acetate;dihydrochloride |
| SMILES | CC(=O)Oc1ccc2ncnc(Nc3ccc(Sc4nccn4C)c(F)c3)c2c1.Cl.Cl |
| InChI | InChI=1S/C20H16FN5O2S.2ClH/c1-12(27)28-14-4-5-17-15(10-14)19(24-11-23-17)25-13-3-6-18(16(21)9-13)29-20-22-7-8-26(20)2;;/h3-11H,1-2H3,(H,23,24,25);2*1H |
| InChIKey | XXSHMTARPCRNIN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.37 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|