C22H20Cl2N2O4 — CID 18970388
2,5-bis(2-chloro-4-methylanilino)cyclohexa-1,4-diene-1,4-dicarboxylic acid (PubChem CID 18970388) has the molecular formula C22H20Cl2N2O4 and a molecular weight of 447.32 g/mol. Its IUPAC name is 2,5-bis(2-chloro-4-methylanilino)cyclohexa-1,4-diene-1,4-dicarboxylic acid.
| Compound Name | 2,5-bis(2-chloro-4-methylanilino)cyclohexa-1,4-diene-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 18970388 |
| Molecular Formula | C22H20Cl2N2O4 |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 2,5-bis(2-chloro-4-methylanilino)cyclohexa-1,4-diene-1,4-dicarboxylic acid |
| SMILES | Cc1ccc(NC2=C(C(=O)O)CC(Nc3ccc(C)cc3Cl)=C(C(=O)O)C2)c(Cl)c1 |
| InChI | InChI=1S/C22H20Cl2N2O4/c1-11-3-5-17(15(23)7-11)25-19-9-14(22(29)30)20(10-13(19)21(27)28)26-18-6-4-12(2)8-16(18)24/h3-8,25-26H,9-10H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | IRCHSMUKVLMUSV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |