C18H16ClN3O4 — CID 18982102
N-[2-[(4-chlorophenyl)methyl]-4-ethoxy-6-oxo-1H-pyrimidin-5-yl]furan-2-carboxamide (PubChem CID 18982102) has the molecular formula C18H16ClN3O4 and a molecular weight of 373.80 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methyl]-4-ethoxy-6-oxo-1H-pyrimidin-5-yl]furan-2-carboxamide.
| Compound Name | N-[2-[(4-chlorophenyl)methyl]-4-ethoxy-6-oxo-1H-pyrimidin-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 18982102 |
| Molecular Formula | C18H16ClN3O4 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methyl]-4-ethoxy-6-oxo-1H-pyrimidin-5-yl]furan-2-carboxamide |
| SMILES | CCOc1nc(Cc2ccc(Cl)cc2)[nH]c(=O)c1NC(=O)c1ccco1 |
| InChI | InChI=1S/C18H16ClN3O4/c1-2-25-18-15(22-16(23)13-4-3-9-26-13)17(24)20-14(21-18)10-11-5-7-12(19)8-6-11/h3-9H,2,10H2,1H3,(H,22,23)(H,20,21,24) |
| InChIKey | SJEISGKGKAARSA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |