C17H31NO4 — CID 18996056
N-(5-methyl-2-oxo-1,3-dioxan-5-yl)dodecanamide (PubChem CID 18996056) has the molecular formula C17H31NO4 and a molecular weight of 313.44 g/mol. Its IUPAC name is N-(5-methyl-2-oxo-1,3-dioxan-5-yl)dodecanamide.
| Compound Name | N-(5-methyl-2-oxo-1,3-dioxan-5-yl)dodecanamide |
|---|---|
| PubChem CID | 18996056 |
| Molecular Formula | C17H31NO4 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | N-(5-methyl-2-oxo-1,3-dioxan-5-yl)dodecanamide |
| SMILES | CCCCCCCCCCCC(=O)NC1(C)COC(=O)OC1 |
| InChI | InChI=1S/C17H31NO4/c1-3-4-5-6-7-8-9-10-11-12-15(19)18-17(2)13-21-16(20)22-14-17/h3-14H2,1-2H3,(H,18,19) |
| InChIKey | XSBVUCDVSLFFDW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|