C14H12F4N2O3 — CID 19001143
2-[4-(2-ethoxy-1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-5-ol (PubChem CID 19001143) has the molecular formula C14H12F4N2O3 and a molecular weight of 332.25 g/mol. Its IUPAC name is 2-[4-(2-ethoxy-1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-5-ol.
| Compound Name | 2-[4-(2-ethoxy-1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-5-ol |
|---|---|
| PubChem CID | 19001143 |
| Molecular Formula | C14H12F4N2O3 |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2-[4-(2-ethoxy-1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-5-ol |
| SMILES | CCOC(F)(F)C(F)(F)Oc1ccc(-c2ncc(O)cn2)cc1 |
| InChI | InChI=1S/C14H12F4N2O3/c1-2-22-13(15,16)14(17,18)23-11-5-3-9(4-6-11)12-19-7-10(21)8-20-12/h3-8,21H,2H2,1H3 |
| InChIKey | LNYKJOQNKZKVGW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|