C8H15ClN4 — CID 19002153
N'-(5-ethyl-1H-pyrazol-3-yl)propanimidamide;hydrochloride (PubChem CID 19002153) has the molecular formula C8H15ClN4 and a molecular weight of 202.69 g/mol. Its IUPAC name is N'-(5-ethyl-1H-pyrazol-3-yl)propanimidamide;hydrochloride.
| Compound Name | N'-(5-ethyl-1H-pyrazol-3-yl)propanimidamide;hydrochloride |
|---|---|
| PubChem CID | 19002153 |
| Molecular Formula | C8H15ClN4 |
| Molecular Weight | 202.69 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | N'-(5-ethyl-1H-pyrazol-3-yl)propanimidamide;hydrochloride |
| SMILES | CC/C(N)=N\c1cc(CC)[nH]n1.Cl |
| InChI | InChI=1S/C8H14N4.ClH/c1-3-6-5-8(12-11-6)10-7(9)4-2;/h5H,3-4H2,1-2H3,(H3,9,10,11,12);1H |
| InChIKey | PPDFLMOHHKZPNP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.69 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|