C7H12N4O — CID 10607196
N-hydroxy-N'-(5-methyl-1H-pyrazol-3-yl)propanimidamide (PubChem CID 10607196) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is N-hydroxy-N'-(5-methyl-1H-pyrazol-3-yl)propanimidamide.
| Compound Name | N-hydroxy-N'-(5-methyl-1H-pyrazol-3-yl)propanimidamide |
|---|---|
| PubChem CID | 10607196 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | N-hydroxy-N'-(5-methyl-1H-pyrazol-3-yl)propanimidamide |
| SMILES | CC/C(=N\c1cc(C)[nH]n1)NO |
| InChI | InChI=1S/C7H12N4O/c1-3-6(11-12)8-7-4-5(2)9-10-7/h4,12H,3H2,1-2H3,(H2,8,9,10,11) |
| InChIKey | OJOWUKGDKMKIKV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|