C28H48N6 — CID 19003925
4-N-(4-aminophenyl)-4-N-[4-[bis[2-(diethylamino)ethyl]amino]butyl]benzene-1,4-diamine (PubChem CID 19003925) has the molecular formula C28H48N6 and a molecular weight of 468.73 g/mol. Its IUPAC name is 4-N-(4-aminophenyl)-4-N-[4-[bis[2-(diethylamino)ethyl]amino]butyl]benzene-1,4-diamine.
| Compound Name | 4-N-(4-aminophenyl)-4-N-[4-[bis[2-(diethylamino)ethyl]amino]butyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 19003925 |
| Molecular Formula | C28H48N6 |
| Molecular Weight | 468.73 g/mol |
| Exact Mass | 468.39 |
| IUPAC Name | 4-N-(4-aminophenyl)-4-N-[4-[bis[2-(diethylamino)ethyl]amino]butyl]benzene-1,4-diamine |
| SMILES | CCN(CC)CCN(CCCCN(c1ccc(N)cc1)c1ccc(N)cc1)CCN(CC)CC |
| InChI | InChI=1S/C28H48N6/c1-5-31(6-2)21-23-33(24-22-32(7-3)8-4)19-9-10-20-34(27-15-11-25(29)12-16-27)28-17-13-26(30)14-18-28/h11-18H,5-10,19-24,29-30H2,1-4H3 |
| InChIKey | ZKQJUQSJTXPUSD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 65.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.73 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|