C15H30N4 — CID 175099218
N',N'-diethylpropane-1,3-diamine;4-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 175099218) has the molecular formula C15H30N4 and a molecular weight of 266.43 g/mol. Its IUPAC name is N',N'-diethylpropane-1,3-diamine;4-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | N',N'-diethylpropane-1,3-diamine;4-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 175099218 |
| Molecular Formula | C15H30N4 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.25 |
| IUPAC Name | N',N'-diethylpropane-1,3-diamine;4-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | CCN(CC)CCCN.CN(C)c1ccc(N)cc1 |
| InChI | InChI=1S/C8H12N2.C7H18N2/c1-10(2)8-5-3-7(9)4-6-8;1-3-9(4-2)7-5-6-8/h3-6H,9H2,1-2H3;3-8H2,1-2H3 |
| InChIKey | VMGGYJRORXZYMI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|