About 1-fluorodecan-2-yl 4-(4-octoxyphenyl)benzoate
1-fluorodecan-2-yl 4-(4-octoxyphenyl)benzoate (PubChem CID 19013929) has the molecular formula C31H45FO3
and a molecular weight of 484.70 g/mol. Its IUPAC name is 1-fluorodecan-2-yl 4-(4-octoxyphenyl)benzoate.
Molecular Properties
| Compound Name | 1-fluorodecan-2-yl 4-(4-octoxyphenyl)benzoate |
| PubChem CID | 19013929 |
| Molecular Formula | C31H45FO3 |
| Molecular Weight | 484.70 g/mol |
| Exact Mass | 484.34 |
| IUPAC Name | 1-fluorodecan-2-yl 4-(4-octoxyphenyl)benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)OC(CF)CCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C31H45FO3/c1-3-5-7-9-11-13-15-30(25-32)35-31(33)28-18-16-26(17-19-28)27-20-22-29(23-21-27)34-24-14-12-10-8-6-4-2/h16-23,30H,3-15,24-25H2,1-2H3 |
| InChIKey | UUJCOVHPEPHVST-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.70 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-fluorodecan-2-yl 4-(4-octoxyphenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluorodecan-2-yl 4-(4-octoxyphenyl)benzoate?
The IUPAC name of 1-fluorodecan-2-yl 4-(4-octoxyphenyl)benzoate (CID 19013929) is 1-fluorodecan-2-yl 4-(4-octoxyphenyl)benzoate.
What is the SMILES notation for 1-fluorodecan-2-yl 4-(4-octoxyphenyl)benzoate?
The canonical SMILES for 1-fluorodecan-2-yl 4-(4-octoxyphenyl)benzoate is CCCCCCCCOc1ccc(-c2ccc(C(=O)OC(CF)CCCCCCCC)cc2)cc1.
What is the InChIKey of 1-fluorodecan-2-yl 4-(4-octoxyphenyl)benzoate?
The InChIKey is UUJCOVHPEPHVST-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H45FO3/c1-3-5-7-9-11-13-15-30(25-32)35-31(33)28-18-16-26(17-19-28)27-20-22-29(23-21-27)34-24-14-12-10-8-6-4-2/h16-23,30H,3-15,24-25H2,1-2H3.
What are the key properties of 1-fluorodecan-2-yl 4-(4-octoxyphenyl)benzoate?
1-fluorodecan-2-yl 4-(4-octoxyphenyl)benzoate has a molecular weight of 484.70 g/mol, XLogP of 9.34, 19 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluorodecan-2-yl 4-(4-octoxyphenyl)benzoate is sourced from PubChem (CID 19013929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).