C19H24ClFO2 — CID 19019222
2-(4-chloro-3-fluorophenyl)-5-[4-[(E)-prop-1-enyl]cyclohexyl]-1,3-dioxane (PubChem CID 19019222) has the molecular formula C19H24ClFO2 and a molecular weight of 338.85 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-5-[4-[(E)-prop-1-enyl]cyclohexyl]-1,3-dioxane.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-5-[4-[(E)-prop-1-enyl]cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 19019222 |
| Molecular Formula | C19H24ClFO2 |
| Molecular Weight | 338.85 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-5-[4-[(E)-prop-1-enyl]cyclohexyl]-1,3-dioxane |
| SMILES | C/C=C/C1CCC(C2COC(c3ccc(Cl)c(F)c3)OC2)CC1 |
| InChI | InChI=1S/C19H24ClFO2/c1-2-3-13-4-6-14(7-5-13)16-11-22-19(23-12-16)15-8-9-17(20)18(21)10-15/h2-3,8-10,13-14,16,19H,4-7,11-12H2,1H3/b3-2+ |
| InChIKey | VWDOVKNMWNSMCQ-NSCUHMNNSA-N |
| XLogP | 5.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.85 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|