About S-propan-2-yl 2-methoxy-2-phenyl-2-[3-(trifluoromethyl)phenyl]ethanethioate
S-propan-2-yl 2-methoxy-2-phenyl-2-[3-(trifluoromethyl)phenyl]ethanethioate (PubChem CID 19020216) has the molecular formula C19H19F3O2S
and a molecular weight of 368.42 g/mol. Its IUPAC name is S-propan-2-yl 2-methoxy-2-phenyl-2-[3-(trifluoromethyl)phenyl]ethanethioate.
Molecular Properties
| Compound Name | S-propan-2-yl 2-methoxy-2-phenyl-2-[3-(trifluoromethyl)phenyl]ethanethioate |
| PubChem CID | 19020216 |
| Molecular Formula | C19H19F3O2S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | S-propan-2-yl 2-methoxy-2-phenyl-2-[3-(trifluoromethyl)phenyl]ethanethioate |
| SMILES | COC(C(=O)SC(C)C)(c1ccccc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H19F3O2S/c1-13(2)25-17(23)18(24-3,14-8-5-4-6-9-14)15-10-7-11-16(12-15)19(20,21)22/h4-13H,1-3H3 |
| InChIKey | ZXHAVPKJUVCLLG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-propan-2-yl 2-methoxy-2-phenyl-2-[3-(trifluoromethyl)phenyl]ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-propan-2-yl 2-methoxy-2-phenyl-2-[3-(trifluoromethyl)phenyl]ethanethioate?
The IUPAC name of S-propan-2-yl 2-methoxy-2-phenyl-2-[3-(trifluoromethyl)phenyl]ethanethioate (CID 19020216) is S-propan-2-yl 2-methoxy-2-phenyl-2-[3-(trifluoromethyl)phenyl]ethanethioate.
What is the SMILES notation for S-propan-2-yl 2-methoxy-2-phenyl-2-[3-(trifluoromethyl)phenyl]ethanethioate?
The canonical SMILES for S-propan-2-yl 2-methoxy-2-phenyl-2-[3-(trifluoromethyl)phenyl]ethanethioate is COC(C(=O)SC(C)C)(c1ccccc1)c1cccc(C(F)(F)F)c1.
What is the InChIKey of S-propan-2-yl 2-methoxy-2-phenyl-2-[3-(trifluoromethyl)phenyl]ethanethioate?
The InChIKey is ZXHAVPKJUVCLLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19F3O2S/c1-13(2)25-17(23)18(24-3,14-8-5-4-6-9-14)15-10-7-11-16(12-15)19(20,21)22/h4-13H,1-3H3.
What are the key properties of S-propan-2-yl 2-methoxy-2-phenyl-2-[3-(trifluoromethyl)phenyl]ethanethioate?
S-propan-2-yl 2-methoxy-2-phenyl-2-[3-(trifluoromethyl)phenyl]ethanethioate has a molecular weight of 368.42 g/mol, XLogP of 5.26, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-propan-2-yl 2-methoxy-2-phenyl-2-[3-(trifluoromethyl)phenyl]ethanethioate is sourced from PubChem (CID 19020216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).