C16H23ClO5S — CID 19020747
[5-[(4-chlorophenyl)methyl]-2,2-dimethyl-6-oxabicyclo[3.1.0]hexan-1-yl]methanol;methanesulfonic acid (PubChem CID 19020747) has the molecular formula C16H23ClO5S and a molecular weight of 362.88 g/mol. Its IUPAC name is [5-[(4-chlorophenyl)methyl]-2,2-dimethyl-6-oxabicyclo[3.1.0]hexan-1-yl]methanol;methanesulfonic acid.
| Compound Name | [5-[(4-chlorophenyl)methyl]-2,2-dimethyl-6-oxabicyclo[3.1.0]hexan-1-yl]methanol;methanesulfonic acid |
|---|---|
| PubChem CID | 19020747 |
| Molecular Formula | C16H23ClO5S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | [5-[(4-chlorophenyl)methyl]-2,2-dimethyl-6-oxabicyclo[3.1.0]hexan-1-yl]methanol;methanesulfonic acid |
| SMILES | CC1(C)CCC2(Cc3ccc(Cl)cc3)OC12CO.CS(=O)(=O)O |
| InChI | InChI=1S/C15H19ClO2.CH4O3S/c1-13(2)7-8-14(15(13,10-17)18-14)9-11-3-5-12(16)6-4-11;1-5(2,3)4/h3-6,17H,7-10H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | HILXZODNKCXLQF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|