C44H78N4O8 — CID 19020858
2-(2,2,6,6-tetramethylpiperidin-4-yl)-1-[tris(2,2,6,6-tetramethylpiperidin-4-yl)methyl]propane-1,1,2,3-tetracarboxylic acid (PubChem CID 19020858) has the molecular formula C44H78N4O8 and a molecular weight of 791.13 g/mol. Its IUPAC name is 2-(2,2,6,6-tetramethylpiperidin-4-yl)-1-[tris(2,2,6,6-tetramethylpiperidin-4-yl)methyl]propane-1,1,2,3-tetracarboxylic acid.
| Compound Name | 2-(2,2,6,6-tetramethylpiperidin-4-yl)-1-[tris(2,2,6,6-tetramethylpiperidin-4-yl)methyl]propane-1,1,2,3-tetracarboxylic acid |
|---|---|
| PubChem CID | 19020858 |
| Molecular Formula | C44H78N4O8 |
| Molecular Weight | 791.13 g/mol |
| Exact Mass | 790.58 |
| IUPAC Name | 2-(2,2,6,6-tetramethylpiperidin-4-yl)-1-[tris(2,2,6,6-tetramethylpiperidin-4-yl)methyl]propane-1,1,2,3-tetracarboxylic acid |
| SMILES | CC1(C)CC(C(CC(=O)O)(C(=O)O)C(C(=O)O)(C(=O)O)C(C2CC(C)(C)NC(C)(C)C2)(C2CC(C)(C)NC(C)(C)C2)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C44H78N4O8/c1-34(2)17-26(18-35(3,4)45-34)42(31(51)52,25-30(49)50)44(32(53)54,33(55)56)43(27-19-36(5,6)46-37(7,8)20-27,28-21-38(9,10)47-39(11,12)22-28)29-23-40(13,14)48-41(15,16)24-29/h26-29,45-48H,17-25H2,1-16H3,(H,49,50)(H,51,52)(H,53,54)(H,55,56) |
| InChIKey | PWYZZXOJDOLBHY-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 197.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.13 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|