C20H16N2O4 — CID 19021685
7-methoxy-N-methyl-16,18-dioxa-2-azapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1,3(11),4,6,8,12,14,19-octaene-6-carboxamide (PubChem CID 19021685) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is 7-methoxy-N-methyl-16,18-dioxa-2-azapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1,3(11),4,6,8,12,14,19-octaene-6-carboxamide.
| Compound Name | 7-methoxy-N-methyl-16,18-dioxa-2-azapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1,3(11),4,6,8,12,14,19-octaene-6-carboxamide |
|---|---|
| PubChem CID | 19021685 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 7-methoxy-N-methyl-16,18-dioxa-2-azapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1,3(11),4,6,8,12,14,19-octaene-6-carboxamide |
| SMILES | CNC(=O)c1cc2c(cc1OC)Cc1cc3cc4c(cc3nc1-2)OCO4 |
| InChI | InChI=1S/C20H16N2O4/c1-21-20(23)14-7-13-10(5-16(14)24-2)3-12-4-11-6-17-18(26-9-25-17)8-15(11)22-19(12)13/h4-8H,3,9H2,1-2H3,(H,21,23) |
| InChIKey | HKGMXGXPZFMKML-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |