About 4,5-dihydro-1H-imidazol-1-ium-1-ylmethanol;2-(trimethylazaniumyl)acetate
4,5-dihydro-1H-imidazol-1-ium-1-ylmethanol;2-(trimethylazaniumyl)acetate (PubChem CID 19022489) has the molecular formula C9H20N3O3+
and a molecular weight of 218.28 g/mol. Its IUPAC name is 4,5-dihydro-1H-imidazol-1-ium-1-ylmethanol;2-(trimethylazaniumyl)acetate.
Molecular Properties
| Compound Name | 4,5-dihydro-1H-imidazol-1-ium-1-ylmethanol;2-(trimethylazaniumyl)acetate |
| PubChem CID | 19022489 |
| Molecular Formula | C9H20N3O3+ |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 4,5-dihydro-1H-imidazol-1-ium-1-ylmethanol;2-(trimethylazaniumyl)acetate |
| SMILES | C[N+](C)(C)CC(=O)[O-].OC[NH+]1C=NCC1 |
| InChI | InChI=1S/C5H11NO2.C4H8N2O/c1-6(2,3)4-5(7)8;7-4-6-2-1-5-3-6/h4H2,1-3H3;3,7H,1-2,4H2/p+1 |
| InChIKey | GARSVRXAFCAUJL-UHFFFAOYSA-O |
| XLogP | -3.69 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dihydro-1H-imidazol-1-ium-1-ylmethanol;2-(trimethylazaniumyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1H-imidazol-1-ium-1-ylmethanol;2-(trimethylazaniumyl)acetate?
The IUPAC name of 4,5-dihydro-1H-imidazol-1-ium-1-ylmethanol;2-(trimethylazaniumyl)acetate (CID 19022489) is 4,5-dihydro-1H-imidazol-1-ium-1-ylmethanol;2-(trimethylazaniumyl)acetate.
What is the SMILES notation for 4,5-dihydro-1H-imidazol-1-ium-1-ylmethanol;2-(trimethylazaniumyl)acetate?
The canonical SMILES for 4,5-dihydro-1H-imidazol-1-ium-1-ylmethanol;2-(trimethylazaniumyl)acetate is C[N+](C)(C)CC(=O)[O-].OC[NH+]1C=NCC1.
What is the InChIKey of 4,5-dihydro-1H-imidazol-1-ium-1-ylmethanol;2-(trimethylazaniumyl)acetate?
The InChIKey is GARSVRXAFCAUJL-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H11NO2.C4H8N2O/c1-6(2,3)4-5(7)8;7-4-6-2-1-5-3-6/h4H2,1-3H3;3,7H,1-2,4H2/p+1.
What are the key properties of 4,5-dihydro-1H-imidazol-1-ium-1-ylmethanol;2-(trimethylazaniumyl)acetate?
4,5-dihydro-1H-imidazol-1-ium-1-ylmethanol;2-(trimethylazaniumyl)acetate has a molecular weight of 218.28 g/mol, XLogP of -3.69, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1H-imidazol-1-ium-1-ylmethanol;2-(trimethylazaniumyl)acetate is sourced from PubChem (CID 19022489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).