C9H20N2O4S — CID 19026863
1-[4-(2-hydroxyethyl)piperazin-1-yl]propane-1-sulfonic acid (PubChem CID 19026863) has the molecular formula C9H20N2O4S and a molecular weight of 252.34 g/mol. Its IUPAC name is 1-[4-(2-hydroxyethyl)piperazin-1-yl]propane-1-sulfonic acid.
| Compound Name | 1-[4-(2-hydroxyethyl)piperazin-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 19026863 |
| Molecular Formula | C9H20N2O4S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 1-[4-(2-hydroxyethyl)piperazin-1-yl]propane-1-sulfonic acid |
| SMILES | CCC(N1CCN(CCO)CC1)S(=O)(=O)O |
| InChI | InChI=1S/C9H20N2O4S/c1-2-9(16(13,14)15)11-5-3-10(4-6-11)7-8-12/h9,12H,2-8H2,1H3,(H,13,14,15) |
| InChIKey | XRQSTQMTUCCSJH-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|