C28H32Cl4FN3O — CID 19029031
N-[2,2-bis(4-chlorophenyl)-5-[4-(4-fluorophenyl)piperazin-1-yl]pentyl]formamide;dihydrochloride (PubChem CID 19029031) has the molecular formula C28H32Cl4FN3O and a molecular weight of 587.39 g/mol. Its IUPAC name is N-[2,2-bis(4-chlorophenyl)-5-[4-(4-fluorophenyl)piperazin-1-yl]pentyl]formamide;dihydrochloride.
| Compound Name | N-[2,2-bis(4-chlorophenyl)-5-[4-(4-fluorophenyl)piperazin-1-yl]pentyl]formamide;dihydrochloride |
|---|---|
| PubChem CID | 19029031 |
| Molecular Formula | C28H32Cl4FN3O |
| Molecular Weight | 587.39 g/mol |
| Exact Mass | 585.13 |
| IUPAC Name | N-[2,2-bis(4-chlorophenyl)-5-[4-(4-fluorophenyl)piperazin-1-yl]pentyl]formamide;dihydrochloride |
| SMILES | Cl.Cl.O=CNCC(CCCN1CCN(c2ccc(F)cc2)CC1)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H30Cl2FN3O.2ClH/c29-24-6-2-22(3-7-24)28(20-32-21-35,23-4-8-25(30)9-5-23)14-1-15-33-16-18-34(19-17-33)27-12-10-26(31)11-13-27;;/h2-13,21H,1,14-20H2,(H,32,35);2*1H |
| InChIKey | DUBUDNYFMVAYTO-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.39 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|