C28H26N2O4 — CID 19029936
benzyl 2-(5-phenylmethoxy-1H-indole-3-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 19029936) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is benzyl 2-(5-phenylmethoxy-1H-indole-3-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | benzyl 2-(5-phenylmethoxy-1H-indole-3-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 19029936 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | benzyl 2-(5-phenylmethoxy-1H-indole-3-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1(C(=O)c2c[nH]c3ccc(OCc4ccccc4)cc23)CCCN1 |
| InChI | InChI=1S/C28H26N2O4/c31-26(28(14-7-15-30-28)27(32)34-19-21-10-5-2-6-11-21)24-17-29-25-13-12-22(16-23(24)25)33-18-20-8-3-1-4-9-20/h1-6,8-13,16-17,29-30H,7,14-15,18-19H2 |
| InChIKey | HZEWLYYPLKRVHC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|