C28H34 — CID 19033036
2,7-ditert-butyl-2-(2-ethylcyclopenta-1,3-dien-1-yl)fluorene (PubChem CID 19033036) has the molecular formula C28H34 and a molecular weight of 370.58 g/mol. Its IUPAC name is 2,7-ditert-butyl-2-(2-ethylcyclopenta-1,3-dien-1-yl)fluorene.
| Compound Name | 2,7-ditert-butyl-2-(2-ethylcyclopenta-1,3-dien-1-yl)fluorene |
|---|---|
| PubChem CID | 19033036 |
| Molecular Formula | C28H34 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | 2,7-ditert-butyl-2-(2-ethylcyclopenta-1,3-dien-1-yl)fluorene |
| SMILES | CCC1=C(C2(C(C)(C)C)C=CC3=c4ccc(C(C)(C)C)cc4=CC3=C2)CC=C1 |
| InChI | InChI=1S/C28H34/c1-8-19-10-9-11-25(19)28(27(5,6)7)15-14-24-21(18-28)16-20-17-22(26(2,3)4)12-13-23(20)24/h9-10,12-18H,8,11H2,1-7H3 |
| InChIKey | ULAGIBDOYUEFAW-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |