C32H42 — CID 87109925
2,7-ditert-butyl-1-cyclopenta-1,3-dien-1-yl-2,4-dipropylfluorene (PubChem CID 87109925) has the molecular formula C32H42 and a molecular weight of 426.69 g/mol. Its IUPAC name is 2,7-ditert-butyl-1-cyclopenta-1,3-dien-1-yl-2,4-dipropylfluorene.
| Compound Name | 2,7-ditert-butyl-1-cyclopenta-1,3-dien-1-yl-2,4-dipropylfluorene |
|---|---|
| PubChem CID | 87109925 |
| Molecular Formula | C32H42 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.33 |
| IUPAC Name | 2,7-ditert-butyl-1-cyclopenta-1,3-dien-1-yl-2,4-dipropylfluorene |
| SMILES | CCCC1=CC(CCC)(C(C)(C)C)C(C2=CC=CC2)=C2C=c3cc(C(C)(C)C)ccc3=C12 |
| InChI | InChI=1S/C32H42/c1-9-13-23-21-32(18-10-2,31(6,7)8)29(22-14-11-12-15-22)27-20-24-19-25(30(3,4)5)16-17-26(24)28(23)27/h11-12,14,16-17,19-21H,9-10,13,15,18H2,1-8H3 |
| InChIKey | FIEKGTVPWQHLSQ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |