C40H34 — CID 87110051
1-cyclopenta-1,3-dien-1-yl-2,7-diethyl-2,3,4-triphenylfluorene (PubChem CID 87110051) has the molecular formula C40H34 and a molecular weight of 514.71 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-yl-2,7-diethyl-2,3,4-triphenylfluorene.
| Compound Name | 1-cyclopenta-1,3-dien-1-yl-2,7-diethyl-2,3,4-triphenylfluorene |
|---|---|
| PubChem CID | 87110051 |
| Molecular Formula | C40H34 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-yl-2,7-diethyl-2,3,4-triphenylfluorene |
| SMILES | CCc1ccc2c(c1)=CC1=C(C3=CC=CC3)C(CC)(c3ccccc3)C(c3ccccc3)=C(c3ccccc3)C=21 |
| InChI | InChI=1S/C40H34/c1-3-28-24-25-34-32(26-28)27-35-37(34)36(29-16-8-5-9-17-29)39(31-18-10-6-11-19-31)40(4-2,33-22-12-7-13-23-33)38(35)30-20-14-15-21-30/h5-20,22-27H,3-4,21H2,1-2H3 |
| InChIKey | CACZMNFJYXQAKM-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|