C28H38Si2 — CID 87109866
(1-cyclopenta-1,3-dien-1-yl-2,7-diethyl-5-trimethylsilylfluoren-2-yl)-trimethylsilane (PubChem CID 87109866) has the molecular formula C28H38Si2 and a molecular weight of 430.78 g/mol. Its IUPAC name is (1-cyclopenta-1,3-dien-1-yl-2,7-diethyl-5-trimethylsilylfluoren-2-yl)-trimethylsilane.
| Compound Name | (1-cyclopenta-1,3-dien-1-yl-2,7-diethyl-5-trimethylsilylfluoren-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 87109866 |
| Molecular Formula | C28H38Si2 |
| Molecular Weight | 430.78 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (1-cyclopenta-1,3-dien-1-yl-2,7-diethyl-5-trimethylsilylfluoren-2-yl)-trimethylsilane |
| SMILES | CCc1cc([Si](C)(C)C)c2c(c1)=CC1=C(C3=CC=CC3)C(CC)([Si](C)(C)C)C=CC=21 |
| InChI | InChI=1S/C28H38Si2/c1-9-20-17-22-19-24-23(26(22)25(18-20)29(3,4)5)15-16-28(10-2,30(6,7)8)27(24)21-13-11-12-14-21/h11-13,15-19H,9-10,14H2,1-8H3 |
| InChIKey | LPNKVLFNNMJJAV-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.78 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|