C30H38 — CID 87109725
2,7-ditert-butyl-1-cyclopenta-1,3-dien-1-yl-2,4-diethylfluorene (PubChem CID 87109725) has the molecular formula C30H38 and a molecular weight of 398.63 g/mol. Its IUPAC name is 2,7-ditert-butyl-1-cyclopenta-1,3-dien-1-yl-2,4-diethylfluorene.
| Compound Name | 2,7-ditert-butyl-1-cyclopenta-1,3-dien-1-yl-2,4-diethylfluorene |
|---|---|
| PubChem CID | 87109725 |
| Molecular Formula | C30H38 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | 2,7-ditert-butyl-1-cyclopenta-1,3-dien-1-yl-2,4-diethylfluorene |
| SMILES | CCC1=CC(CC)(C(C)(C)C)C(C2=CC=CC2)=C2C=c3cc(C(C)(C)C)ccc3=C12 |
| InChI | InChI=1S/C30H38/c1-9-20-19-30(10-2,29(6,7)8)27(21-13-11-12-14-21)25-18-22-17-23(28(3,4)5)15-16-24(22)26(20)25/h11-13,15-19H,9-10,14H2,1-8H3 |
| InChIKey | ZXUSOGWSCOPNQH-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |