About 5-tert-butylinden-2-one
5-tert-butylinden-2-one (PubChem CID 175126948) has the molecular formula C13H14O
and a molecular weight of 186.25 g/mol. Its IUPAC name is 5-tert-butylinden-2-one.
Molecular Properties
| Compound Name | 5-tert-butylinden-2-one |
| PubChem CID | 175126948 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 5-tert-butylinden-2-one |
| SMILES | CC(C)(C)c1ccc2c(c1)=CC(=O)C=2 |
| InChI | InChI=1S/C13H14O/c1-13(2,3)11-5-4-9-7-12(14)8-10(9)6-11/h4-8H,1-3H3 |
| InChIKey | FJDHMWADZZXEGV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-tert-butylinden-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butylinden-2-one?
The IUPAC name of 5-tert-butylinden-2-one (CID 175126948) is 5-tert-butylinden-2-one.
What is the SMILES notation for 5-tert-butylinden-2-one?
The canonical SMILES for 5-tert-butylinden-2-one is CC(C)(C)c1ccc2c(c1)=CC(=O)C=2.
What is the InChIKey of 5-tert-butylinden-2-one?
The InChIKey is FJDHMWADZZXEGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O/c1-13(2,3)11-5-4-9-7-12(14)8-10(9)6-11/h4-8H,1-3H3.
What are the key properties of 5-tert-butylinden-2-one?
5-tert-butylinden-2-one has a molecular weight of 186.25 g/mol, XLogP of 1.13, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butylinden-2-one is sourced from PubChem (CID 175126948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).